773-72-8 Usage
Chemical structure
1-Aziridin-1-yl-2,3-dihydro-1H-inden-2-ol consists of an aziridine ring and a dihydroindene ring structure.
Reactivity
Highly reactive due to the presence of the aziridine functional group.
Toxicity
Potentially toxic, requiring proper safety measures during handling and use.
Applications
Used in the synthesis of various pharmaceuticals and agrochemicals.
Building block
The aziridine functional group makes it a useful building block for creating other complex organic compounds.
Pharmacological properties
The dihydroindene ring structure gives it potential pharmacological properties.
Research
Ongoing research into the compound's potential applications and risks, as it may hold promise for new drug development but also presents potential hazards to human health and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 773-72-8 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,7 and 3 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 773-72:
(5*7)+(4*7)+(3*3)+(2*7)+(1*2)=88
88 % 10 = 8
So 773-72-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H13NO/c13-10-7-8-3-1-2-4-9(8)11(10)12-5-6-12/h1-4,10-11,13H,5-7H2
