78946-83-5 Usage
Description
(14R,18R)-14,18-dimethyl-1,4,7,10,13-pentaoxa-16-azacyclooctadecane is a cyclic chemical compound with the molecular formula C13H29NO5. It is a macrocycle, which means it has a large ring-shaped structure consisting of at least twelve atoms. (14R,18R)-14,18-dimethyl-1,4,7,10,13-pentaoxa-16-azacyclooctadecane contains both oxygen and nitrogen atoms, as well as methyl groups, which contribute to its unique structure and properties. Its potential applications in pharmaceuticals and materials science make it a valuable compound for research and development in various fields.
Uses
Used in Pharmaceutical Industry:
(14R,18R)-14,18-dimethyl-1,4,7,10,13-pentaoxa-16-azacyclooctadecane is used as a potential candidate for pharmaceutical applications due to its unique structure and properties. The presence of oxygen and nitrogen atoms in the compound may allow it to interact with biological targets and potentially be used in the development of new drugs.
Used in Materials Science:
(14R,18R)-14,18-dimethyl-1,4,7,10,13-pentaoxa-16-azacyclooctadecane is also used in materials science for its potential applications in the development of new materials. (14R,18R)-14,18-dimethyl-1,4,7,10,13-pentaoxa-16-azacyclooctadecane's cyclic structure and the presence of oxygen and nitrogen atoms may contribute to its ability to form stable complexes or interact with other molecules, making it a promising candidate for use in the creation of advanced materials.
Check Digit Verification of cas no
The CAS Registry Mumber 78946-83-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,9,4 and 6 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 78946-83:
(7*7)+(6*8)+(5*9)+(4*4)+(3*6)+(2*8)+(1*3)=195
195 % 10 = 5
So 78946-83-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H29NO5/c1-13-11-15-12-14(2)20-10-8-18-6-4-16-3-5-17-7-9-19-13/h13-15H,3-12H2,1-2H3
78946-83-5Relevant articles and documents
Synthesis of Monoaza Crown Ethers from N,N-Diamines and Oligoethylene Glycol Di(p-toluenesulfonates) or Corresponding Dichlorides
Maeda, Hirokazu,Furuyoshi, Shigeo,Nakatsuji, Yohji,Okahara, Mitsuo
, p. 212 - 218 (2007/10/02)
Monoaza crown ethers were prepared in satisfactory yields by the one-step reaction between diethanolamine or N,N-diamines and oligoethylene glycol di(p-toluenesulfonates) or corresponding dichlorides in t-butyl alcohol/dioxane in the presence of sodium or potassium t-butoxide.The reaction conditions in the preparation of monoaza 15- and 18-crown ethers were studied.Various monoaza crown ethers having substituents were also prepared and their properties were investigated.
