814-90-4 Usage
Description
CHROMIUM (IC) OXALATE is a yellow to yellowish-green crystalline powder that exhibits stable chemical properties, as it is not appreciably oxidized by moist air.
Uses
Used in Chemical Industry:
CHROMIUM (IC) OXALATE is used as a chemical compound for various applications in the chemical industry, including as a catalyst, pigment, or reagent, due to its stable chemical properties and unique characteristics.
Used in Research and Development:
CHROMIUM (IC) OXALATE is utilized as a research compound for studying its properties, reactions, and potential applications in various fields, such as materials science, pharmaceuticals, and environmental science.
Used in Analytical Chemistry:
CHROMIUM (IC) OXALATE can be employed as an analytical reagent for the detection, quantification, or analysis of specific substances in various samples, taking advantage of its chemical properties and reactivity.
Used in Environmental Applications:
CHROMIUM (IC) OXALATE may be used in environmental applications, such as water or air treatment processes, to remove or reduce the presence of contaminants, pollutants, or other harmful substances, leveraging its chemical properties and reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 814-90-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 8,1 and 4 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 814-90:
(5*8)+(4*1)+(3*4)+(2*9)+(1*0)=74
74 % 10 = 4
So 814-90-4 is a valid CAS Registry Number.
InChI:InChI=1/C2H2O4.Cr/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/p-2
