82885-72-1 Usage
Description
(E,E)-3-(3-(1-Oxo-3-phenyl-2-propenyl)phenyl)-2-propenoic acid, also known as chalcone-3-carboxylic acid, is a chemical compound belonging to the class of organic compounds known as chalcones. It features a 1,3-diphenylpropenone moiety and is characterized by its yellow crystalline solid appearance and limited solubility in water. This versatile compound has been studied for its potential pharmacological activities, which include anti-inflammatory, anti-cancer, and anti-microbial properties. Additionally, it has been investigated for its use as a fluorescence chemosensor for metal ions, showcasing its potential in various fields such as medicine, chemistry, and materials science.
Uses
Used in Pharmaceutical Applications:
Chalcone-3-carboxylic acid is used as a pharmaceutical agent for its potential anti-inflammatory, anti-cancer, and anti-microbial properties. Its diverse pharmacological activities make it a promising candidate for the development of new drugs to treat various diseases and conditions.
Used in Chemical Applications:
In the field of chemistry, chalcone-3-carboxylic acid is utilized as a fluorescence chemosensor for metal ions. This application takes advantage of its ability to selectively interact with metal ions, making it a valuable tool for detecting and analyzing these ions in various chemical processes.
Used in Materials Science:
Chalcone-3-carboxylic acid's unique properties also make it a candidate for use in materials science, where it could potentially be incorporated into the development of new materials with specific characteristics, such as those with anti-microbial or anti-cancer properties.
Used in Research and Development:
Due to its diverse potential applications, chalcone-3-carboxylic acid is also used in research and development for further exploration of its properties and potential uses in various industries, including pharmaceuticals, chemistry, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 82885-72-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,8,8 and 5 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 82885-72:
(7*8)+(6*2)+(5*8)+(4*8)+(3*5)+(2*7)+(1*2)=171
171 % 10 = 1
So 82885-72-1 is a valid CAS Registry Number.
InChI:InChI=1/C18H14O3/c19-17(11-9-14-5-2-1-3-6-14)16-8-4-7-15(13-16)10-12-18(20)21/h1-13H,(H,20,21)/b11-9+,12-10+
