82885-76-5 Usage
Description
(E,E)-3-(2-Methoxy-5-(1-oxo-3-phenyl-2-propenyl)phenyl)-2-propenoic acid, also known by its IUPAC name 2-[(2E)-3-(2-Methoxy-5-phenyl-2-oxo-2,3-dihydro-1H-benzo[b][1,4]dioxepin-3-yl)-1-oxoprop-2-enyl]-3-methoxyphenyl acetic acid, is an organic compound with a molecular formula of C21H18O4. It belongs to the family of carboxylic acids and phenylpropanoids. This yellow crystalline solid is insoluble in water but soluble in organic solvents. It exhibits potential biological and pharmacological activities, making it a valuable compound for research and pharmaceutical applications.
Uses
Used in Pharmaceutical Applications:
(E,E)-3-(2-Methoxy-5-(1-oxo-3-phenyl-2-propenyl)phenyl)-2-propenoic acid is used as an active pharmaceutical ingredient for its potential biological and pharmacological activities. Its unique chemical structure allows it to interact with various biological targets, making it a promising candidate for the development of new drugs.
Used in Research Applications:
In the field of research, (E,E)-3-(2-Methoxy-5-(1-oxo-3-phenyl-2-propenyl)phenyl)-2-propenoic acid serves as a valuable compound for studying its interactions with different biological systems. Its use in research can lead to a better understanding of its potential therapeutic applications and help in the development of novel treatments for various diseases.
Used in Chemical Synthesis:
(E,E)-3-(2-Methoxy-5-(1-oxo-3-phenyl-2-propenyl)phenyl)-2-propenoic acid can also be used as a key intermediate in the synthesis of more complex organic compounds. Its unique structure and reactivity make it a useful building block for the creation of new molecules with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Used in Analytical Chemistry:
Due to its distinct chemical properties, (E,E)-3-(2-Methoxy-5-(1-oxo-3-phenyl-2-propenyl)phenyl)-2-propenoic acid can be employed as a reference compound or standard in analytical chemistry. It can be used to calibrate instruments, validate analytical methods, or as a control in various chemical assays, ensuring the accuracy and reliability of experimental results.
Check Digit Verification of cas no
The CAS Registry Mumber 82885-76-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,8,8 and 5 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 82885-76:
(7*8)+(6*2)+(5*8)+(4*8)+(3*5)+(2*7)+(1*6)=175
175 % 10 = 5
So 82885-76-5 is a valid CAS Registry Number.
InChI:InChI=1/C19H16O4/c1-23-18-11-8-15(13-16(18)9-12-19(21)22)17(20)10-7-14-5-3-2-4-6-14/h2-13H,1H3,(H,21,22)/b10-7+,12-9+
82885-76-5Relevant articles and documents
New cinnamoyl-cinnamic acid derivative, and its use as pharmaceutical
-
, (2008/06/13)
The present invention relates to a new cinnamoyl-cinnamic acid derivative selected from the group constituted by: (i) the m-cinnamoyl-cinnamic acid derivatives of formula STR1 in which: Xo,X1,X2,X3,X4, which are identical or different, each represent an atom of hydrogen, a halogen, a lower alkyl group, a lower alkoxy group, the group NRR' (where R and R' identical or different, each represent an atom of hydrogen or a lower alkyl group), the group NO2, CF3 or OH; R1 represents an atom of hydrogen or a lower alkyl group; R2 represents an atom of hydrogen or the methyl group; Y represents a group OH, OR3 (where R3 is a lower alkyl group), NRR' (where R and R' are defined as hereinabove) or the group O(CH2)n NR4 R5 (where n is an integer of value 1 to 5--and preferably 2 or 3)--; and R4 and R5, identical or different, each represent an atom of hydrogen, a lower alkyl group and may form with the nitrogen atom to which they are bonded a heterocyclic group of 5 to 7 vertices capable of being substituted and of comprising one or more other heteroatoms such as N and O); (ii) their geometrical isomers; and (iii) their salts. It also relates to its method of preparation and its use as pharmaceutical.
