876-19-7 Usage
Description
2-Hydroxy-3-imidazol-1-yl-propanoic acid is an imidazolyl carboxylic acid that is lactic acid in which one of the methyl hydrogens is substituted by an imidazol-1-yl group.
Uses
Used in Pharmaceutical Industry:
2-Hydroxy-3-imidazol-1-yl-propanoic acid is used as a pharmaceutical compound for its potential therapeutic applications. Its unique structure allows it to interact with various biological targets, making it a promising candidate for the development of new drugs.
Used in Research Applications:
2-Hydroxy-3-imidazol-1-yl-propanoic acid is used as a research tool in biochemical and pharmaceutical research. Its ability to modulate biological processes and interact with specific targets makes it valuable for studying the mechanisms of various diseases and for the development of novel therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 876-19-7 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 8,7 and 6 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 876-19:
(5*8)+(4*7)+(3*6)+(2*1)+(1*9)=97
97 % 10 = 7
So 876-19-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N2O3/c9-5(6(10)11)3-8-2-1-7-4-8/h1-2,4-5,9H,3H2,(H,10,11)