883-21-6 Usage
Description
1-Methoxy-2-naphthoic acid is an organic compound derived from 1-methoxynaphthalene, featuring a methoxy group and a naphthoic acid structure. It can be synthesized through various chemical reactions, including the use of potassium tert-butoxide and butyllithium in the presence of cyclohexane and tetrahydrofuran. 1-METHOXY-2-NAPHTHOIC ACID is known for its potential applications in the synthesis of various other organic compounds and has been identified for its use in the preparation of specific chemical entities.
Uses
Used in Chemical Synthesis:
1-Methoxy-2-naphthoic acid is used as a key intermediate in the synthesis of various organic compounds, including 2-(1-methoxy-2-naphthyl)-4,4-dimethyl-2-oxazoline. Its unique structure allows it to serve as a building block for the creation of complex molecules with specific properties and applications.
Used in the Synthesis of Specific Compounds:
1-Methoxy-2-naphthoic acid is utilized in the synthesis of several specific compounds, such as:
1. 1-sec-butyl-2-naphthoic acid
2. 1-tert-butyl-2-naphthoic acid
3. 1-ethyl-2-naphthoic acid
4. 1-vinyl-2-naphthoic acid
5. 1-phenyl-2-naphthoic acid
6. 1-(2,5-dimethylphenyl)-2-naphthoic acid
7. 2′-methoxy-[1,1′-binaphthalene]-2-carboxylic acid
These synthesized compounds may have various applications across different industries, such as pharmaceuticals, materials science, or as specialty chemicals, depending on their specific properties and characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 883-21-6 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 8,8 and 3 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 883-21:
(5*8)+(4*8)+(3*3)+(2*2)+(1*1)=86
86 % 10 = 6
So 883-21-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H10O3/c1-15-11-9-5-3-2-4-8(9)6-7-10(11)12(13)14/h2-7H,1H3,(H,13,14)
883-21-6Relevant articles and documents
Hydrogen peroxide oxidation of naphthalene derivatives catalyzed by poly (bis-1,2-diphenylene) diselenide
Giurg,Syper,Mlochowski
, p. 231 - 238 (2007/10/03)
Oxidation of 1- and 2-substituted naphthalenes (1) with 30% hydrogen peroxide in the presence of poly(bis-1,2-diphenylene) diselenide (PPDS) has been investigated. Depending on the substrate used trans-2-carboxycinnamic acid (2), and its isomer, (1-oxo-1,3-dihydroisobenzofuran-1-yl)acetic acid (3) or 2-naphthoic acid (4b) was a major product. Oxidation of hydroxynaphthalenes 1b and 1c is a convenient way to obtain trans-2-carboxy cinnamic acid (2) in almost quantitative yield. The mechanism of the reaction is postulated.