90948-03-1 Usage
Description
1-Bromo-2-iodonaphthalene is a chemical compound that belongs to the class of organic compounds known as naphthalenes. It is a derivative of naphthalene with bromine and iodine atoms attached to its structure, which gives it unique properties and reactivity. 1-Bromo-2-iodonaphthalene is recognized for its potential in various fields of chemistry, including organic synthesis, pharmaceuticals, agrochemicals, and materials science, making it a valuable building block for the synthesis of complex organic molecules.
Uses
Used in Organic Synthesis:
1-Bromo-2-iodonaphthalene is used as a reagent in organic synthesis for its unique structure and reactivity, which allows for the creation of complex organic molecules. Its presence in reactions can facilitate the formation of desired products, making it an important component in the synthesis of various compounds.
Used in Chemical Research:
In the field of chemical research, 1-Bromo-2-iodonaphthalene is utilized as a reagent to study and understand various chemical reactions and mechanisms. Its unique properties make it a valuable tool for probing and elucidating reaction pathways and for the development of new synthetic methods.
Used in Pharmaceutical Industry:
1-Bromo-2-iodonaphthalene is used as a building block in the pharmaceutical industry for the development of new drugs. Its unique structure can be incorporated into drug candidates to potentially enhance their efficacy, selectivity, or other pharmacological properties.
Used in Agrochemical Industry:
In agrochemicals, 1-Bromo-2-iodonaphthalene is used as a starting material or intermediate in the synthesis of various agrochemical products, such as pesticides and herbicides. Its reactivity and structural features can contribute to the development of more effective and targeted agrochemicals.
Used in Materials Science:
1-Bromo-2-iodonaphthalene is also used in materials science for the development of new materials with specific properties. Its unique structure can be leveraged to create materials with tailored characteristics for various applications, such as in electronics, coatings, or other advanced technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 90948-03-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,9,4 and 8 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 90948-03:
(7*9)+(6*0)+(5*9)+(4*4)+(3*8)+(2*0)+(1*3)=151
151 % 10 = 1
So 90948-03-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H6BrI/c11-10-8-4-2-1-3-7(8)5-6-9(10)12/h1-6H
90948-03-1Relevant articles and documents
The metalation of 1- and 2-(trifluoromethyl)naphthalenes: Noteworthy site selectivities
Cottet, Fabrice,Castagnetti, Eva,Schlosser, Manfred
, p. 798 - 803 (2007/10/03)
This article provides insight into the various factors by which electronegative substituents affect the kinetic acidity of arenes and, more specifically, naphthalenes. Both 1- and 2-(trifluoromethyl)naphthalenes were consecutively treated with an organometallic or lithium dialkylamide-type base and carbon dioxide. Due to single electron-transfer triggered side reactions, the yields of (trifluoromethyl)naphthoic acids were moderate to poor. 1-(Trifluoromethyl)naphthalene was exclusively attacked at the 2-position as expected. The 2-isomer reacted with tert-butyllithium in the presence of potassium tert-butoxide solely at the 1-position, but with sec-butyllithium in the presence of N,N,N′,N′-tetramethylethylene-diamine concomitantly at the 3- and 4-positions. Authentic samples of the key acids 1, 4, 5 and 6 were prepared based on independent, unambiguous methods.