92286-36-7 Usage
Description
4-ALLYL-5-(3-CHLOROPHENYL)-4H-1,2,4-TRIAZOLE-3-THIOL is an organic compound belonging to the triazole family, characterized by the molecular formula C9H8ClN3S. It features an allyl group, a chlorophenyl group, and a thiol group, which contribute to its unique chemical properties and potential applications.
Uses
Used in Pharmaceutical Industry:
4-ALLYL-5-(3-CHLOROPHENYL)-4H-1,2,4-TRIAZOLE-3-THIOL is used as a building block in the synthesis of pharmaceuticals for its ability to be incorporated into complex molecular structures, potentially leading to the development of new drugs with various therapeutic effects.
Used in Agrochemical Industry:
In the agrochemical sector, 4-ALLYL-5-(3-CHLOROPHENYL)-4H-1,2,4-TRIAZOLE-3-THIOL is utilized as a component in the creation of agrochemicals, such as pesticides and fungicides, due to its potential biological activities like antimicrobial or antifungal properties.
Further Research:
More research is required to fully explore the potential uses and effects of 4-ALLYL-5-(3-CHLOROPHENYL)-4H-1,2,4-TRIAZOLE-3-THIOL, particularly in understanding its biological activities and optimizing its applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 92286-36-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,2,2,8 and 6 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 92286-36:
(7*9)+(6*2)+(5*2)+(4*8)+(3*6)+(2*3)+(1*6)=147
147 % 10 = 7
So 92286-36-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H10ClN3S/c1-2-6-15-10(13-14-11(15)16)8-4-3-5-9(12)7-8/h2-5,7H,1,6H2,(H,14,16)
