932-49-0 Usage
Description
1-(2-Hydroxyethyl)imidazolidine-2-thione is a chemical compound that is formed as a degradation product of monoethanolamines during the absorption cleaning of exhaust gas. It is characterized by its unique structure and properties, which make it suitable for various applications.
Uses
Used in Exhaust Gas Cleaning:
1-(2-Hydroxyethyl)imidazolidine-2-thione is used as a degradation product in the absorption cleaning of exhaust gas. It is formed during the process of using monoethanolamines to clean exhaust gas, which helps in reducing harmful emissions and improving air quality.
In the context of exhaust gas cleaning, monoethanolamines are commonly used to remove pollutants such as sulfur dioxide and other acidic gases from industrial emissions. The formation of 1-(2-Hydroxyethyl)imidazolidine-2-thione as a degradation product highlights the chemical reactions that occur during this process, contributing to the overall effectiveness of the cleaning system.
Check Digit Verification of cas no
The CAS Registry Mumber 932-49-0 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 9,3 and 2 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 932-49:
(5*9)+(4*3)+(3*2)+(2*4)+(1*9)=80
80 % 10 = 0
So 932-49-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H10N2OS/c8-4-3-7-2-1-6-5(7)9/h8H,1-4H2,(H,6,9)
