952-17-0 Usage
Description
(3,4-DIETHOXYPHENYL)(OXO)ACETALDEHYDE HYDRATE is a chemical compound with the molecular formula C12H16O4. It is a derivative of acetaldehyde, featuring a phenyl ring with two ethoxy groups attached at the 3 and 4 positions. The presence of the oxo group classifies it as an aldehyde, and the hydrate form suggests it contains water molecules. (3,4-DIETHOXYPHENYL)(OXO)ACETALDEHYDE HYDRATE is utilized in organic synthesis and serves as a building block for various pharmaceuticals and agrochemicals. It may also hold potential for the development of new materials and chemical processes. However, it is crucial to handle this compound with care due to possible health and environmental risks if mismanaged.
Uses
Used in Organic Synthesis:
(3,4-DIETHOXYPHENYL)(OXO)ACETALDEHYDE HYDRATE is used as a key intermediate in the synthesis of complex organic molecules for various applications.
Used in Pharmaceutical Industry:
(3,4-DIETHOXYPHENYL)(OXO)ACETALDEHYDE HYDRATE is used as a building block for the development of new pharmaceuticals, contributing to the creation of novel drugs with potential therapeutic benefits.
Used in Agrochemical Industry:
(3,4-DIETHOXYPHENYL)(OXO)ACETALDEHYDE HYDRATE is used as a component in the production of agrochemicals, such as pesticides and fertilizers, to enhance agricultural productivity and crop protection.
Used in Material Science:
(3,4-DIETHOXYPHENYL)(OXO)ACETALDEHYDE HYDRATE may be utilized as a component in the development of new materials, potentially leading to advancements in various industries.
Used in Chemical Process Development:
(3,4-DIETHOXYPHENYL)(OXO)ACETALDEHYDE HYDRATE may serve as a catalyst or reactant in the development of innovative chemical processes, improving efficiency and sustainability in chemical production.
Check Digit Verification of cas no
The CAS Registry Mumber 952-17-0 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 9,5 and 2 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 952-17:
(5*9)+(4*5)+(3*2)+(2*1)+(1*7)=80
80 % 10 = 0
So 952-17-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H14O4/c1-3-15-11-6-5-9(10(14)8-13)7-12(11)16-4-2/h5-8H,3-4H2,1-2H3
