1. Introduction of Polymyxin B sulfate (CAS No. 1405-20-5)

Product name: Polymyxin B sulfate
CAS registry number: 1405-20-5
Molecular Formula: C₅₆H₉₈N₁₆O₁₃.H₂SO₄
Molecular Weight: 1301.56 
EINECS: 215-774-7

2. Polymyxin B sulfate (CAS No. 1405-20-5) chemical structure

The chemical structure of Polymyxin B sulfate (CAS No. 1405-20-5) are as below:



And you could convert the following datas into the chemical structure
(1). InChI: InChI=1S/C48H82N16O13.H2O4S/c1-27(2)24-37-47(76)59-32(11-19-52)41(70)56-31(10-18-51)43(72)61-35(14-22-65)39(68)54-21-13-34(45(74)57-33(12-20-53)44(73)64-38(48(77)63-37)25-28-6-4-3-5-7-28)60-42(71)30(9-17-50)58-46(75)36(15-23-66)62-40(69)29(8-16-49)55-26-67;1-5(2,3)4/h3-7,26-27,29-38,65-66H,8-25,49-53H2,1-2H3,(H,54,68)(H,55,67)(H,56,70)(H,57,74)(H,58,75)(H,59,76)(H,60,71)(H,61,72)(H,62,69)(H,63,77)(H,64,73);(H2,1,2,3,4)
(2). InChIKey: InChIKey=HNDFYNOVSOOGDU-UHFFFAOYSA-N
(3). Smiles: CC(C)C[C@@H]1NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H](CCN)NC(=O)[C@@H](CCNC(=O)[C@@H](CCO)NC(=O)[C@@H](CCN)NC(=O)[C@@H](CCN)NC1=O)NC(=O)[C@@H](CCN)NC(=O)[C@@H](CCO)NC(=O)[C@@H](CCN)NC=O.OS(O)(=O)=O

3. Polymyxin B sulfate (CAS No. 1405-20-5) for sale

(1). Polymyxin B sulfate with assay of standard usp31: This product could be produced by Hangzhou Holypharm Biotech Co., Ltd. This company is a professional supplier of active pharmaceutical ingredients and intermediates; agrochemicals and Veterinary products. It is specialized in contract R&D and custom manufacturing.
(2). Polymyxin B sulfate 99%: This product could be produced by Afine chemicals Ltd. This company is specialized in the fine chemicals and pharmaceuticals and it has enjoyed great popularity in world markets.
(3). Polymyxin B sulfate with assay of 6500iu/mg min: This product could be produced by Hangzhou Dawn Ray Pharmaceutical Co.,Ltd.

4. Polymyxin B sulfate (CAS No. 1405-20-5) prices

Polymyxin B sulfate price will flunctuate with the change of the market, with influence from the costs changing of raw material, the decision by Polymyxin B sulfate manufacturers, and so on. If you want to buy Polymyxin B sulfate, you need to inquiry some more Polymyxin B sulfate producers and compare Polymyxin B sulfate costs and then choose the best prices on Polymyxin B sulfate. And the above three Polymyxin B sulfate suppliers could be your good choice in buying.