127582-76-7 Usage
Description
Fmoc-7-amino-heptanoic acid is an alkane chain with terminal Fmoc-protected amine and carboxylic acid groups. It is a white powder that can be used as a PROTAC linker in the synthesis of proteolysis-targeting chimeras (PROTACs). The Fmoc group can be deprotected under basic conditions to obtain the free amine, which can be used for further conjugations. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g., EDC or HATU) to form a stable amide bond.
Uses
Used in Pharmaceutical Industry:
Fmoc-7-amino-heptanoic acid is used as a pharmaceutical intermediate for the synthesis of various drugs and bioactive compounds. Its unique structure allows for the formation of stable amide bonds and the deprotection of the Fmoc group, enabling further conjugations and modifications.
Used in PROTAC Synthesis:
Fmoc-7-amino-heptanoic acid serves as a PROTAC linker, which is essential in the development of targeted protein degradation therapies. As a component of PROTACs, it plays a crucial role in modulating protein-protein interactions and promoting the degradation of specific proteins, offering a new approach to treating various diseases.
Used in Chemical Synthesis:
Due to its reactivity and functional groups, Fmoc-7-amino-heptanoic acid can be employed in various chemical synthesis processes. Its terminal carboxylic acid and Fmoc-protected amine make it a versatile building block for the creation of complex organic molecules and compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 127582-76-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,7,5,8 and 2 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 127582-76:
(8*1)+(7*2)+(6*7)+(5*5)+(4*8)+(3*2)+(2*7)+(1*6)=147
147 % 10 = 7
So 127582-76-7 is a valid CAS Registry Number.
InChI:InChI=1/C22H25NO4/c24-21(25)13-3-1-2-8-14-23-22(26)27-15-20-18-11-6-4-9-16(18)17-10-5-7-12-19(17)20/h4-7,9-12,20H,1-3,8,13-15H2,(H,23,26)(H,24,25)