16947-89-0 Usage
General Description
Alpha-BOC-gamma-Z-(DL)-diaminobutyric acid is a chemical compound used in the synthesis of peptides and therapeutic drugs. It is a derivative of the naturally occurring amino acid, lysine, and is often utilized as a building block for complex peptide structures. The "ALPHA-BOC" in its name refers to the presence of a tert-butyloxycarbonyl protecting group, which helps to control the reactivity of the compound during the synthesis process. The gamma-Z bond in the compound's structure signifies the presence of a zwitterionic group, which gives the molecule its unique properties. Overall, the compound plays a crucial role in the development of pharmaceuticals and biotechnological products.
Check Digit Verification of cas no
The CAS Registry Mumber 16947-89-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,9,4 and 7 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 16947-89:
(7*1)+(6*6)+(5*9)+(4*4)+(3*7)+(2*8)+(1*9)=150
150 % 10 = 0
So 16947-89-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H23N.C10H18N2O6.C8H10/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-10(2,3)18-9(17)12-6(7(13)14)4-5-11-8(15)16;1-2-8-6-4-3-5-7-8/h11-13H,1-10H2;6,11H,4-5H2,1-3H3,(H,12,17)(H,13,14)(H,15,16);3-7H,2H2,1H3/t;6-;/m.0./s1