1020243-02-0 Usage
General Description
1H-Indazole, 4,5-dichloro- is a chemical compound that belongs to the indazole family. It is characterized by two chlorine atoms attached to the 4 and 5 positions of the indazole ring. 1H-Indazole, 4,5-dichloro- has various applications in the field of organic chemistry, pharmaceuticals, and agrochemicals. It is used as a building block in the synthesis of various pharmaceutical compounds and agrochemicals. Additionally, it has been studied for its potential biological activities and has shown promise in various biological assays. Its unique structure and properties make it a versatile compound with potential applications in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 1020243-02-0 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,2,0,2,4 and 3 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 1020243-02:
(9*1)+(8*0)+(7*2)+(6*0)+(5*2)+(4*4)+(3*3)+(2*0)+(1*2)=60
60 % 10 = 0
So 1020243-02-0 is a valid CAS Registry Number.
InChI:InChI=1S/C7H4Cl2N2/c8-5-1-2-6-4(7(5)9)3-10-11-6/h1-3H,(H,10,11)