103222-11-3 Usage
Description
Vapreotide, also known as S676750, is a synthetic somatostatin analog that exhibits a wide range of pharmacological properties. It is designed to mimic the actions of the naturally occurring hormone somatostatin, which plays a crucial role in regulating various physiological processes, including the inhibition of hormone secretion, reduction of gastrointestinal motility, and modulation of immune responses. Vapreotide's unique structure allows it to selectively target specific somatostatin receptors, providing targeted therapeutic effects with minimal side effects.
Uses
Used in Gastroenterology:
Vapreotide is used as a therapeutic agent for the treatment of acute variceal bleeding, a life-threatening condition that occurs when the veins in the esophagus or stomach rupture due to increased pressure. It works by constricting blood vessels, reducing blood flow to the varices, and promoting clot formation, thereby effectively controlling bleeding episodes and improving patient outcomes.
Used in Oncology:
Vapreotide is also employed in the management of various types of cancer, particularly neuroendocrine tumors, where it exhibits antiproliferative and antiangiogenic effects. By inhibiting the secretion of growth factors and hormones, vapreotide can slow down tumor growth and reduce the formation of new blood vessels that supply nutrients to the tumor, ultimately leading to a decrease in tumor size and metastasis.
Used in Endocrinology:
In the field of endocrinology, vapreotide is utilized for the treatment of conditions characterized by excessive hormone secretion, such as acromegaly and carcinoid syndrome. It helps regulate hormone levels by binding to somatostatin receptors on the pituitary gland and other endocrine tissues, thereby normalizing hormone production and alleviating symptoms associated with these disorders.
Used in Drug Delivery Systems:
To enhance the efficacy and bioavailability of vapreotide, researchers have developed innovative drug delivery systems, such as liposomes, nanoparticles, and hydrogels. These systems aim to improve the stability, solubility, and targeted delivery of vapreotide, ensuring optimal therapeutic effects while minimizing potential side effects and drug resistance.
Check Digit Verification of cas no
The CAS Registry Mumber 103222-11-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,2,2 and 2 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 103222-11:
(8*1)+(7*0)+(6*3)+(5*2)+(4*2)+(3*2)+(2*1)+(1*1)=53
53 % 10 = 3
So 103222-11-3 is a valid CAS Registry Number.
InChI:InChI=1/C57H70N12O9S2/c1-32(2)49-57(78)68-48(55(76)64-44(50(60)71)26-35-28-61-41-16-8-6-14-38(35)41)31-80-79-30-47(67-51(72)40(59)24-33-12-4-3-5-13-33)56(77)65-45(25-34-19-21-37(70)22-20-34)53(74)66-46(27-36-29-62-42-17-9-7-15-39(36)42)54(75)63-43(52(73)69-49)18-10-11-23-58/h3-9,12-17,19-22,28-29,32,40,43-49,61-62,70H,10-11,18,23-27,30-31,58-59H2,1-2H3,(H2,60,71)(H,63,75)(H,64,76)(H,65,77)(H,66,74)(H,67,72)(H,68,78)(H,69,73)