10344-38-4 Usage
Molecular structure
A complex structure belonging to the class of benzopyranopyridinones and is a derivative of 5H-[1]benzopyrano[4,3-c]pyridin-5-one.
Functional groups
Contains a hydroxy group (-OH), a methyl group (-CH3), and a pentyl group (C5H11), which contribute to its molecular complexity.
Biological and pharmacological activities
Due to its intricate structure, it has potential biological and pharmacological activities, making it a subject of interest for further research in drug discovery and development.
Chemical class
It is a part of the benzopyranopyridinone class of compounds, which are known for their diverse range of biological activities.
Potential applications
Given its potential biological and pharmacological activities, this compound may be useful in the development of new drugs or therapies for various medical conditions.
Research interest
The compound's complex structure and potential activities make it a valuable target for further research in the fields of chemistry, biology, and pharmacology.
Synthesis
The synthesis of this compound may involve multiple steps and require specific reagents and conditions to form the desired molecular structure.
Structural analysis
Techniques such as nuclear magnetic resonance (NMR) spectroscopy, mass spectrometry, and X-ray crystallography can be used to analyze and confirm the structure of this compound.
Stability
The stability of this compound under various conditions (e.g., temperature, pH, light exposure) may be an important factor to consider for its potential applications.
Solubility
Understanding the solubility of this compound in different solvents can help in determining its suitability for various applications, such as drug formulation and delivery.
Check Digit Verification of cas no
The CAS Registry Mumber 10344-38-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,3,4 and 4 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 10344-38:
(7*1)+(6*0)+(5*3)+(4*4)+(3*4)+(2*3)+(1*8)=64
64 % 10 = 4
So 10344-38-4 is a valid CAS Registry Number.
InChI:InChI=1/C18H23NO3/c1-3-4-5-6-12-9-15(20)17-14-11-19(2)8-7-13(14)18(21)22-16(17)10-12/h9-10,20H,3-8,11H2,1-2H3
