115102-54-0 Usage
Description
[4-AMINO-5-(ETHOXYCARBONYL)PYRIMIDIN-2-YL]THIOACETIC ACID is a thiol derivative of pyrimidine, characterized by a pyrimidinyl thio group attached to an acetic acid moiety, with an amino and ethoxycarbonyl substituent on the pyrimidine ring. This chemical compound has potential applications in various fields due to its unique structure and properties.
Uses
Used in Pharmaceutical Industry:
[4-AMINO-5-(ETHOXYCARBONYL)PYRIMIDIN-2-YL]THIOACETIC ACID is used as an intermediate in the synthesis of various medications for its potential anti-inflammatory, antiviral, and anticancer properties.
Used in Anti-inflammatory Applications:
[4-AMINO-5-(ETHOXYCARBONYL)PYRIMIDIN-2-YL]THIOACETIC ACID is used as an anti-inflammatory agent due to its thiol group, which may help in reducing inflammation and associated symptoms.
Used in Antiviral Applications:
In the field of antiviral research, [4-AMINO-5-(ETHOXYCARBONYL)PYRIMIDIN-2-YL]THIOACETIC ACID is used as a potential therapeutic agent for its ability to inhibit viral replication and reduce the severity of viral infections.
Used in Anticancer Applications:
[4-AMINO-5-(ETHOXYCARBONYL)PYRIMIDIN-2-YL]THIOACETIC ACID is used as a potential anticancer agent, as it has been studied for its ability to target and inhibit cancer cell growth and proliferation.
Used in Drug Development:
In the development of novel therapeutic agents, [4-AMINO-5-(ETHOXYCARBONYL)PYRIMIDIN-2-YL]THIOACETIC ACID is used as a key compound for its potential to be incorporated into new drugs targeting various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 115102-54-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,5,1,0 and 2 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 115102-54:
(8*1)+(7*1)+(6*5)+(5*1)+(4*0)+(3*2)+(2*5)+(1*4)=70
70 % 10 = 0
So 115102-54-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H11N3O4S/c1-2-16-8(15)5-3-11-9(12-7(5)10)17-4-6(13)14/h3H,2,4H2,1H3,(H,13,14)(H2,10,11,12)/p-1
