123334-16-7 Usage
Description
TETRAHYDROXY-1,4-QUINONE HYDRATE is a black crystalline powder that is known for its unique chemical properties. It is a compound with a quinone structure, which is characterized by the presence of two carbonyl groups attached to an aromatic ring. This structure gives it various applications in different industries.
Uses
Used in Pharmaceutical Industry:
TETRAHYDROXY-1,4-QUINONE HYDRATE is used as an effector of xanthine oxidase for its ability to modulate the activity of this enzyme, which plays a crucial role in the metabolism of purines and has implications in various diseases.
Used in Chemical Analysis:
TETRAHYDROXY-1,4-QUINONE HYDRATE is used as a titration indicator for barium (Ba) and sulfate (SO4) ions. Its chemical properties allow it to change color in the presence of these ions, making it a valuable tool for detecting and quantifying their concentrations in various samples.
Purification Methods
Crystallise the quinone from water. [Beilstein 8 H 534, 8 II 572, 8 III 4204, 8 IV 3604.]
Check Digit Verification of cas no
The CAS Registry Mumber 123334-16-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,3,3,3 and 4 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 123334-16:
(8*1)+(7*2)+(6*3)+(5*3)+(4*3)+(3*4)+(2*1)+(1*6)=87
87 % 10 = 7
So 123334-16-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H4O6.H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;/h7-8,11-12H;1H2
