13347-41-6 Usage
Description
2-[(diisopropyl)amino]ethyl 9H-xanthene-9-carboxylate is a chemical compound derived from the xanthene family, characterized by its diisopropylaminoethyl functional group. 2-[(diisopropyl)amino]ethyl 9H-xanthene-9-carboxylate is known for its potential applications in the pharmaceutical industry due to its unique structural properties and interactions with biological systems.
Uses
Used in Pharmaceutical Industry:
2-[(diisopropyl)amino]ethyl 9H-xanthene-9-carboxylate is used as a key intermediate in the synthesis of deuterium-labelled propantheline bromide, which is an important compound in the development of pharmaceuticals. The deuterium label allows for better understanding of the compound's behavior in biological systems and can lead to improved drug design and efficacy.
Additionally, 2-[(diisopropyl)amino]ethyl 9H-xanthene-9-carboxylate is used as a potential antispasmodic agent. Antispasmodic agents are drugs that help relieve muscle spasms and pain, often used in the treatment of conditions like irritable bowel syndrome, biliary colic, and other gastrointestinal disorders. The compound's ability to act as an antispasmodic agent makes it a valuable candidate for further research and development in the pharmaceutical field.
Check Digit Verification of cas no
The CAS Registry Mumber 13347-41-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,3,4 and 7 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 13347-41:
(7*1)+(6*3)+(5*3)+(4*4)+(3*7)+(2*4)+(1*1)=86
86 % 10 = 6
So 13347-41-6 is a valid CAS Registry Number.
InChI:InChI=1/C22H27NO3/c1-15(2)23(16(3)4)13-14-25-22(24)21-17-9-5-7-11-19(17)26-20-12-8-6-10-18(20)21/h5-12,15-16,21H,13-14H2,1-4H3