13468-02-5 Usage
Description
Dimethyl(2-phenoxyethyl)amine, also known as N,N-Dimethyl-2-phenoxyethanamine, is an organic compound with the molecular formula C10H15NO. It is a derivative of phenoxyethanamine, featuring two methyl groups attached to the nitrogen atom. dimethyl(2-phenoxyethyl)amine is known for its potential applications in the pharmaceutical and chemical industries due to its unique structural properties.
Uses
Used in Pharmaceutical Industry:
Dimethyl(2-phenoxyethyl)amine is used as a key intermediate compound for the synthesis of histone deacetylase (HDAC) inhibitors. These inhibitors play a crucial role in the development of drugs targeting various diseases, including cancer, by modulating gene expression and cellular processes. The compound's ability to interact with HDAC enzymes makes it a valuable component in the creation of therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 13468-02-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,4,6 and 8 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 13468-02:
(7*1)+(6*3)+(5*4)+(4*6)+(3*8)+(2*0)+(1*2)=95
95 % 10 = 5
So 13468-02-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H15NO/c1-11(2)8-9-12-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3
