53977-19-8 Usage
Description
6-CHLORO-4-OXO-1,4-DIHYDRO-QUINOLINE-3-CARBOXYLIC ACID is a synthetic chemical compound with the molecular formula C10H5ClNO3. It is a quinolone carboxylic acid derivative characterized by the presence of a chlorine atom, a carbonyl group, and a carboxylic acid functional group. These features endow the compound with unique properties, including potential antimicrobial and anti-inflammatory activities. This makes it a promising candidate for the development of new antibiotics and anti-inflammatory drugs in the pharmaceutical industry.
Uses
Used in Pharmaceutical Industry:
6-CHLORO-4-OXO-1,4-DIHYDRO-QUINOLINE-3-CARBOXYLIC ACID is used as a potential antibacterial agent for the development of new antibiotics. Its quinolone carboxylic acid structure contributes to its antimicrobial properties, making it a valuable compound in the fight against bacterial infections.
Additionally, it is used as a potential anti-inflammatory agent for the development of new anti-inflammatory drugs. 6-CHLORO-4-OXO-1,4-DIHYDRO-QUINOLINE-3-CARBOXYLIC ACID's unique properties, including its chlorine atom and functional groups, may contribute to its ability to reduce inflammation and alleviate symptoms associated with inflammatory conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 53977-19-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,9,7 and 7 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 53977-19:
(7*5)+(6*3)+(5*9)+(4*7)+(3*7)+(2*1)+(1*9)=158
158 % 10 = 8
So 53977-19-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H6ClNO3/c11-5-1-2-8-6(3-5)9(13)7(4-12-8)10(14)15/h1-4H,(H,12,13)(H,14,15)/p-1
53977-19-8Relevant articles and documents
Use of polyphosphoric acid in the hydrolysis of chromone esters
He, Xungui,Li, Zhiyu,You, Qidong
, p. 709 - 714 (2002)
Hydrolysis of esters was achieved in fairly high yield (59-98%) using polyphosphoric acid (PPA). The reagent was particularly useful for the hydrolysis of chromone side chain esters without ring opening.
