557-24-4 Usage
Description
Maleamic acid, also known as N-(hydroxymethyl)maleamic acid, is a dicarboxylic acid monoamide derived from maleamic acid. It is a solid compound with unique chemical properties that make it suitable for various applications in different industries.
Uses
Used in Pharmaceutical Industry:
Maleamic acid is used as an intermediate in the preparation of a new conjugated agent for the radioiodination of proteins. This application is significant because it allows for the development of new diagnostic and therapeutic agents that can be used in the medical field.
Used in Chemical Synthesis:
Due to its unique chemical properties, maleamic acid can be used as a building block in the synthesis of various complex organic compounds. This makes it a valuable reagent in the chemical industry for creating new molecules with specific functions and properties.
Used in Research and Development:
Maleamic acid can also be utilized in research and development settings to study its properties and potential applications. This can lead to the discovery of new uses and advancements in various fields, including pharmaceuticals, materials science, and biotechnology.
Purification Methods
Crystallise it from EtOH. [Beilstein 2 H 752, 2 II 646, 2 III 1927, 2 IV 1927.] IRRITANT.
Check Digit Verification of cas no
The CAS Registry Mumber 557-24-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,5 and 7 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 557-24:
(5*5)+(4*5)+(3*7)+(2*2)+(1*4)=74
74 % 10 = 4
So 557-24-4 is a valid CAS Registry Number.
InChI:InChI=1/C4H5NO3/c5-3(6)1-2-4(7)8/h1-2H,(H2,5,6)(H,7,8)/b2-1+
