66882-16-4 Usage
General Description
2-[[4-[(2-cyano-3-nitrophenyl)azo]-m-tolyl](2-acetoxyethyl)amino]ethyl acetate is a chemical compound with a complex structure consisting of a diazo group, nitro group, cyano group, and various aromatic and aliphatic functional groups. It is a yellow to orange powder with potential applications in the field of organic synthesis, dyes, and pigments. The compound is derived from the reaction between an amino compound and acetic acid, resulting in the formation of the acetoxyethyl group. With its unique chemical structure, 2-[[4-[(2-cyano-3-nitrophenyl)azo]-m-tolyl](2-acetoxyethyl)amino]ethyl acetate may have diverse properties and potential uses in various industrial and research applications.
Check Digit Verification of cas no
The CAS Registry Mumber 66882-16-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,8,8 and 2 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 66882-16:
(7*6)+(6*6)+(5*8)+(4*8)+(3*2)+(2*1)+(1*6)=164
164 % 10 = 4
So 66882-16-4 is a valid CAS Registry Number.
InChI:InChI=1/C22H23N5O6/c1-15-12-19(26(8-10-32-16(2)28)9-11-33-17(3)29)4-6-21(15)24-25-22-7-5-20(27(30)31)13-18(22)14-23/h4-7,12-13H,8-11H2,1-3H3/b25-24+