82701-91-5 Usage
General Description
1,7-Phenanthroline-5,6-dione, also known as o-Phenanthrolinequinone, is a chemical compound with the molecular formula C12H6N2O2. It is a yellow crystalline solid that is used in the synthesis of various coordination compounds and metal-organic frameworks. 1,7-Phenanthroline-5,6-dione is commonly used as a chelating agent in analytical chemistry and biochemistry to selectively bind and remove metal ions from a solution. 1,7-Phenanthroline-5,6-dione has also been studied for its potential use in the treatment of certain diseases, such as cancer and bacterial infections, due to its ability to disrupt metal ion homeostasis in cells. Additionally, it has been investigated for its antimicrobial and antifungal properties, making it a versatile compound with various potential applications in different fields.
Check Digit Verification of cas no
The CAS Registry Mumber 82701-91-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,7,0 and 1 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 82701-91:
(7*8)+(6*2)+(5*7)+(4*0)+(3*1)+(2*9)+(1*1)=125
125 % 10 = 5
So 82701-91-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H6N2O2/c15-11-8-4-2-5-13-9(8)7-3-1-6-14-10(7)12(11)16/h1-6H
82701-91-5Relevant articles and documents
NOVEL ADDITION OF NITROALKANES TO o-QUINONES
Itoh, Shinobu,Nii, Kazumi,Mure, Minae,Ohshiro, Yoshiki
, p. 3975 - 3978 (2007/10/02)
A novel addition reaction of nitroalkanes to o-quinones is found to give 1,3-dioxole derivatives.
