952182-30-8 Usage
General Description
Methyl 3-bromo-1h-pyrrolo-[3,2-b]pyridine-2-carboxylate is a chemical compound that belongs to the class of pyrrolopyridine derivatives. It is commonly used in organic synthesis and pharmaceutical research due to its potential biological activities. The compound has a molecular formula of C10H7BrN2O2 and a molecular weight of 272.08 g/mol. Methyl 3-bromo-1h-pyrrolo-[3,2-b]pyridine-2-carboxylate is known for its potential applications in the development of drugs for various diseases, including cancer, infectious diseases, and neurological disorders. Its chemical structure and properties make it an important building block for the synthesis of new pharmaceutical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 952182-30-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,2,1,8 and 2 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 952182-30:
(8*9)+(7*5)+(6*2)+(5*1)+(4*8)+(3*2)+(2*3)+(1*0)=168
168 % 10 = 8
So 952182-30-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H7BrN2O2/c1-14-9(13)8-6(10)7-5(12-8)3-2-4-11-7/h2-4,12H,1H3
