988-75-0 Usage
General Description
Z-GLU-TYR-OH is a chemical compound that consists of three amino acids: Z (benzyloxycarbonyl) group, glutamic acid, tyrosine, and a hydroxyl group. It is commonly used in the synthesis of peptide chains due to its ability to link amino acids together. Z-GLU-TYR-OH is often utilized in the field of biochemistry and pharmaceutical research as a building block for creating larger peptide and protein structures. It is also studied for its potential therapeutic applications in the treatment of various diseases and medical conditions. The Z-GLU-TYR-OH compound plays a crucial role in peptide synthesis and has the potential to contribute to the development of groundbreaking medications and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 988-75-0 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 9,8 and 8 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 988-75:
(5*9)+(4*8)+(3*8)+(2*7)+(1*5)=120
120 % 10 = 0
So 988-75-0 is a valid CAS Registry Number.
InChI:InChI=1/C22H24N2O8/c25-16-8-6-14(7-9-16)12-18(21(29)30)23-20(28)17(10-11-19(26)27)24-22(31)32-13-15-4-2-1-3-5-15/h1-9,17-18,25H,10-13H2,(H,23,28)(H,24,31)(H,26,27)(H,29,30)