127271-65-2 Usage
Description
4-Fluoro-3-(trifluoromethyl)anisole is a colorless liquid that serves as an important raw material and intermediate in various chemical processes. It is widely utilized in the synthesis of organic compounds, pharmaceuticals, agrochemicals, and dyes due to its unique chemical properties.
Uses
Used in Organic Synthesis:
4-Fluoro-3-(trifluoromethyl)anisole is used as a key intermediate in organic synthesis for the production of various chemical compounds. Its unique structure allows for versatile reactions, making it a valuable component in the synthesis of a wide range of organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-fluoro-3-(trifluoromethyl)anisole is used as a building block for the development of new drugs. Its specific functional groups enable the creation of novel pharmaceutical agents with potential therapeutic applications.
Used in Agrochemical Industry:
4-Fluoro-3-(trifluoromethyl)anisole is employed as an intermediate in the synthesis of agrochemicals, such as pesticides and herbicides. Its incorporation into these products can enhance their effectiveness and selectivity in controlling pests and unwanted plant growth.
Used in Dye Industry:
In the dye industry, 4-fluoro-3-(trifluoromethyl)anisole is used as a precursor for the production of various dyes. Its unique properties contribute to the development of dyes with specific color characteristics and improved performance in different applications.
Check Digit Verification of cas no
The CAS Registry Mumber 127271-65-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,7,2,7 and 1 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 127271-65:
(8*1)+(7*2)+(6*7)+(5*2)+(4*7)+(3*1)+(2*6)+(1*5)=122
122 % 10 = 2
So 127271-65-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H10BrFO/c1-2-5-12-9-4-3-7(10)6-8(9)11/h3-4,6H,2,5H2,1H3