228267-64-9 Usage
Description
(3S,4R)-4-Benzyl-3-(3-methylpentanoyl)-oxazolidin-2-one is a chiral chemical compound belonging to the oxazolidinone class. It features a stereocenter at the third and fourth positions, and is characterized by the presence of a benzyl group and a methylpentanoyl group. These structural elements confer specific reactivity and properties, making it a valuable intermediate in various organic synthesis processes. Its oxazolidinone structure also positions it as a potential candidate for medicinal chemistry research and drug development.
Uses
Used in Pharmaceutical Synthesis:
(3S,4R)-4-Benzyl-3-(3-methylpentanoyl)-oxazolidin-2-one is used as an intermediate in the synthesis of pharmaceuticals due to its unique structural features and reactivity. Its benzyl and methylpentanoyl groups contribute to the development of new drugs with specific therapeutic properties.
Used in Agrochemical Synthesis:
In the agrochemical industry, (3S,4R)-4-benzyl-3-(3-methylpentanoyl)-oxazolidin-2-one serves as an intermediate for the synthesis of agrochemicals, potentially leading to the creation of new pesticides or other agricultural products that can improve crop yields and protect against pests.
Used in Medicinal Chemistry Research:
(3S,4R)-4-Benzyl-3-(3-methylpentanoyl)-oxazolidin-2-one is utilized in medicinal chemistry research for its potential applications in drug development. Its oxazolidinone structure makes it a promising candidate for the design and synthesis of novel therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 228267-64-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,8,2,6 and 7 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 228267-64:
(8*2)+(7*2)+(6*8)+(5*2)+(4*6)+(3*7)+(2*6)+(1*4)=149
149 % 10 = 9
So 228267-64-9 is a valid CAS Registry Number.
InChI:InChI=1/C16H21NO3/c1-3-12(2)9-15(18)17-14(11-20-16(17)19)10-13-7-5-4-6-8-13/h4-8,12,14H,3,9-11H2,1-2H3/t12-,14+/m0/s1
228267-64-9Relevant articles and documents
Total synthesis of (+)-belactosin A.
Armstrong, Alan,Scutt, James N
, p. 510 - 511 (2007/10/03)
A concise first total synthesis of the antitumour antibiotic belactosin A is reported, involving coupling of beta-lactone carboxylic acid 3 with N-Ala-aminocyclopropyl alanine 11.
