453-13-4 Usage
Description
1,3-Difluoro-2-propanol is a clear, colorless liquid with unique chemical properties that make it suitable for various applications across different industries.
Uses
Used in Pharmaceutical Industry:
1,3-Difluoro-2-propanol is used as a synthetic intermediate for the production of 1,3-difluoroacetone, which is an important compound in the synthesis of various pharmaceuticals. Its unique chemical structure allows for the creation of novel drugs with potential therapeutic benefits.
Used in Chemical Synthesis:
1,3-Difluoro-2-propanol is used as a versatile building block in the synthesis of various organic compounds due to its distinct chemical properties. Its ability to participate in different types of chemical reactions makes it a valuable asset in the development of new materials and products.
Used in Research and Development:
1,3-Difluoro-2-propanol is utilized as a reagent in research and development laboratories for the exploration of new chemical reactions and the synthesis of novel compounds. Its unique properties enable scientists to investigate new pathways and develop innovative applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 453-13-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,5 and 3 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 453-13:
(5*4)+(4*5)+(3*3)+(2*1)+(1*3)=54
54 % 10 = 4
So 453-13-4 is a valid CAS Registry Number.
InChI:InChI=1/C3H4F2O/c4-1-3(6)2-5/h1-2H2
