874-05-5 Usage
Description
1H-Indazol-3-ylamine, also known as 1H-Indazol-3-amine, is an organic compound that serves as a reagent in the synthesis of indazole derivatives. It is characterized by its light yellow crystalline appearance and is known for its potential applications in the development of antimicrobial and antitumor agents.
Uses
Used in Pharmaceutical Industry:
1H-Indazol-3-ylamine is used as a reagent for the preparation of indazole derivatives, which are considered potential antimicrobial and antitumor agents. Its role in the synthesis of these derivatives is crucial for the development of new drugs that can combat various types of infections and cancers.
Used in Chemical Research:
1H-Indazol-3-ylamine is also utilized in chemical research for the study and development of novel compounds with potential applications in various fields. Its unique chemical properties make it a valuable component in the synthesis of new molecules with diverse functionalities.
Check Digit Verification of cas no
The CAS Registry Mumber 874-05-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 8,7 and 4 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 874-05:
(5*8)+(4*7)+(3*4)+(2*0)+(1*5)=85
85 % 10 = 5
So 874-05-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H7N3/c8-7-5-3-1-2-4-6(5)9-10-7/h1-4H,(H3,8,9,10)
