1. what is citric acid (CAS No. 77-92-9)

Citric acid Product Name: Citric acid
Citric acid CAS Registry Number: 77-92-9
Synonyms: Citric acid anhydrous; 2-Hydroxy-1,2,3-propanetricarboxylic acid; 2-Hydroxytricarballylic acid 
Citric acid Formula: C₆H₈O₇
Molecular Weight: 192.12
EINECS: 201-069-1

2. Safety Information of Citric acid (CAS No. 77-92-9)

Citric acid Hazard Codes: Xi,C 
Citric acid Risk Statements: 41-36/37/38-36/38-37/38-34 
Citric acid Safety Statements: 26-39-37/39-24/25-36/37/39-45-36
RIDADR: UN 1789 8/PG 3
WGK Germany: 1
RTECS: GE735000
F: 9
Hazardous Substances Data: 77-92-9(Hazardous Substances Data)

3. Citric acid (CAS No. 77-92-9) chemical structure


The chemical structure of Citric acid (CAS No. 77-92-9) are as below:
(1). InChI: InChI=1S/C6H8O7/c7-3(8)1-6(13,5(11)12)2-4(9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)
(2). InChIKey: InChIKey=KRKNYBCHXYNGOX-UHFFFAOYSA-N
(3). Smiles: C(CC(O)=O)(CC(O)=O)(C(O)=O)O