53978-73-7 Usage
General Description
Z-N-Methyl-D-valine is a synthetic chemical compound used in various pharmaceutical and research applications. It is a derivative of the amino acid valine and is classified as a methylated compound due to the addition of a methyl group to the amino group of the valine molecule. This modification can enhance the compound's stability, bioavailability, and pharmacological properties. Z-N-Methyl-D-valine is commonly used in the synthesis of peptides and peptidomimetics, as well as in the development of pharmaceutical drugs and biologically active compounds. Its unique structure and properties make it a valuable tool in the field of medicinal chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 53978-73-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,9,7 and 8 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 53978-73:
(7*5)+(6*3)+(5*9)+(4*7)+(3*8)+(2*7)+(1*3)=167
167 % 10 = 7
So 53978-73-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H13NO2/c1-4(2)5(7-3)6(8)9/h4-5,7H,1-3H3,(H,8,9)/t5-/m1/s1