759-67-1 Usage
Description
Ethyl 2-fluoro-3-oxopentanoate is an ester organic compound characterized by the presence of a fluorine atom and a ketone group within its molecular structure. It is known for its unique chemical properties and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
Ethyl 2-fluoro-3-oxopentanoate is used as a pharmaceutical intermediate for the synthesis of various medicinal compounds. Its unique structure allows it to serve as a key building block in the development of new drugs, particularly those targeting specific biological pathways or receptors.
Used in Chemical Synthesis:
In the field of chemical synthesis, Ethyl 2-fluoro-3-oxopentanoate can be utilized as a versatile reagent or precursor in the preparation of a wide range of organic compounds. Its fluorinated nature and ketone functionality make it a valuable component in the synthesis of specialty chemicals, agrochemicals, and other advanced materials.
Used in Research and Development:
Ethyl 2-fluoro-3-oxopentanoate is also employed in research and development settings, where it can be used to explore novel chemical reactions, investigate the effects of fluorination on molecular properties, and develop new synthetic methodologies. Its unique structure and reactivity make it an interesting target for academic and industrial research efforts.
Check Digit Verification of cas no
The CAS Registry Mumber 759-67-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,5 and 9 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 759-67:
(5*7)+(4*5)+(3*9)+(2*6)+(1*7)=101
101 % 10 = 1
So 759-67-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H11FO3/c1-3-5(9)6(8)7(10)11-4-2/h6H,3-4H2,1-2H3