1187-50-4 Usage
Description
L-LEUCYL-GLYCYL-GLYCINE is a tripeptide consisting of one L-leucine and two glycine residues joined in sequence. It is a naturally occurring compound that plays a significant role in various biological processes.
Uses
Used in Pharmaceutical Industry:
L-LEUCYL-GLYCYL-GLYCINE is used as a therapeutic agent for its potential role in treating various diseases. Its unique structure allows it to interact with specific biological targets, making it a promising candidate for drug development.
Used in Cosmetic Industry:
L-LEUCYL-GLYCYL-GLYCINE is used as an active ingredient in cosmetic products for its potential skin benefits. It may help improve skin elasticity, hydration, and overall skin health.
Used in Nutritional Supplements:
L-LEUCYL-GLYCYL-GLYCINE is used as a dietary supplement to support muscle growth and recovery. Its presence in the body may contribute to the maintenance of lean muscle mass and overall physical performance.
Used in Research Applications:
L-LEUCYL-GLYCYL-GLYCINE is used as a research tool to study the structure and function of peptides and their interactions with biological systems. It can provide valuable insights into the development of new therapeutic agents and understanding the underlying mechanisms of various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 1187-50-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,1,8 and 7 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 1187-50:
(6*1)+(5*1)+(4*8)+(3*7)+(2*5)+(1*0)=74
74 % 10 = 4
So 1187-50-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H19N3O4/c1-6(2)3-7(11)10(17)13-4-8(14)12-5-9(15)16/h6-7H,3-5,11H2,1-2H3,(H,12,14)(H,13,17)(H,15,16)
